triisopropyl phosphate


isopropyl orthophosphate; isopropyl phosphate; triisopropyl orthophosphate; triisopropyl phosphate
CAS RN:[513-02-0]
Formula:C9H21O4P; 224.24 g/mol
InChiKey:OXFUXNFMHFCELM-UHFFFAOYSA-N
SMILES:CC(C)O[P](=O)(OC(C)C)OC(C)C
Molecular structure of triisopropyl phosphate
Density:0.987 g/mL
Molar volume:227.3 mL/mol
Refractive index:1.406
Molecular refractive power:55.79 mL/mol
Dipole moment:2.86 D
Boiling point:219 °C
Surface tension:25.68 dyn/cm

Isomers

dibutyl methyl phosphate
Molecular structure of dibutyl methyl phosphate
diethyl pentyl phosphate
Molecular structure of diethyl pentyl phosphate
triisopropyl phosphate
Molecular structure of triisopropyl phosphate
tripropyl phosphate
Molecular structure of tripropyl phosphate